(2S)-4-phenyl-2,3-dihydro-1,5-benzothiazepine-2-carboxylic acid

C16H13NO2S — CID 745309

IUPAC(2S)-4-phenyl-2,3-dihydro-1,5-benzothiazepine-2-carboxylic acid
SMILESO=C(O)[C@@H]1CC(c2ccccc2)=Nc2ccccc2S1
InChIInChI=1S/C16H13NO2S/c18-16(19)15-10-13(11-6-2-1-3-7-11)17-12-8-4-5-9-14(12)20-15/h1-9,15H,10H2,(H,18,19)/t15-/m0/s1
InChIKeyBUHNCRFGISFTRP-HNNXBMFYSA-N
MW283.35 g/mol
LogP3.76
Rot. Bonds2

About (2S)-4-phenyl-2,3-dihydro-1,5-benzothiazepine-2-carboxylic acid

(2S)-4-phenyl-2,3-dihydro-1,5-benzothiazepine-2-carboxylic acid (PubChem CID 745309) has the molecular formula C16H13NO2S and a molecular weight of 283.35 g/mol. Its IUPAC name is (2S)-4-phenyl-2,3-dihydro-1,5-benzothiazepine-2-carboxylic acid.

Molecular Properties

Compound Name(2S)-4-phenyl-2,3-dihydro-1,5-benzothiazepine-2-carboxylic acid
PubChem CID745309
Molecular FormulaC16H13NO2S
Molecular Weight283.35 g/mol
Exact Mass283.07
IUPAC Name(2S)-4-phenyl-2,3-dihydro-1,5-benzothiazepine-2-carboxylic acid
SMILESO=C(O)[C@@H]1CC(c2ccccc2)=Nc2ccccc2S1
InChIInChI=1S/C16H13NO2S/c18-16(19)15-10-13(11-6-2-1-3-7-11)17-12-8-4-5-9-14(12)20-15/h1-9,15H,10H2,(H,18,19)/t15-/m0/s1
InChIKeyBUHNCRFGISFTRP-HNNXBMFYSA-N
XLogP3.76
TPSA49.66 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500283.35
LogP ≤ 53.76
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze (2S)-4-phenyl-2,3-dihydro-1,5-benzothiazepine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-4-phenyl-2,3-dihydro-1,5-benzothiazepine-2-carboxylic acid?
The IUPAC name of (2S)-4-phenyl-2,3-dihydro-1,5-benzothiazepine-2-carboxylic acid (CID 745309) is (2S)-4-phenyl-2,3-dihydro-1,5-benzothiazepine-2-carboxylic acid.
What is the SMILES notation for (2S)-4-phenyl-2,3-dihydro-1,5-benzothiazepine-2-carboxylic acid?
The canonical SMILES for (2S)-4-phenyl-2,3-dihydro-1,5-benzothiazepine-2-carboxylic acid is O=C(O)[C@@H]1CC(c2ccccc2)=Nc2ccccc2S1.
What is the InChIKey of (2S)-4-phenyl-2,3-dihydro-1,5-benzothiazepine-2-carboxylic acid?
The InChIKey is BUHNCRFGISFTRP-HNNXBMFYSA-N. The full InChI is InChI=1S/C16H13NO2S/c18-16(19)15-10-13(11-6-2-1-3-7-11)17-12-8-4-5-9-14(12)20-15/h1-9,15H,10H2,(H,18,19)/t15-/m0/s1.
What are the key properties of (2S)-4-phenyl-2,3-dihydro-1,5-benzothiazepine-2-carboxylic acid?
(2S)-4-phenyl-2,3-dihydro-1,5-benzothiazepine-2-carboxylic acid has a molecular weight of 283.35 g/mol, XLogP of 3.76, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4-phenyl-2,3-dihydro-1,5-benzothiazepine-2-carboxylic acid is sourced from PubChem (CID 745309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).