C17H26N2O6S — CID 7453410
(3R)-1-(3,4-dimethoxyphenyl)sulfonyl-N-(3-hydroxypropyl)piperidine-3-carboxamide (PubChem CID 7453410) has the molecular formula C17H26N2O6S and a molecular weight of 386.47 g/mol. Its IUPAC name is (3R)-1-(3,4-dimethoxyphenyl)sulfonyl-N-(3-hydroxypropyl)piperidine-3-carboxamide.
| Compound Name | (3R)-1-(3,4-dimethoxyphenyl)sulfonyl-N-(3-hydroxypropyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 7453410 |
| Molecular Formula | C17H26N2O6S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | (3R)-1-(3,4-dimethoxyphenyl)sulfonyl-N-(3-hydroxypropyl)piperidine-3-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCC[C@@H](C(=O)NCCCO)C2)cc1OC |
| InChI | InChI=1S/C17H26N2O6S/c1-24-15-7-6-14(11-16(15)25-2)26(22,23)19-9-3-5-13(12-19)17(21)18-8-4-10-20/h6-7,11,13,20H,3-5,8-10,12H2,1-2H3,(H,18,21)/t13-/m1/s1 |
| InChIKey | YXSNNOTVZXYAAF-CYBMUJFWSA-N |
| XLogP | 0.60 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|