C17H25ClN2O — CID 745369
3-chloro-4-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide (PubChem CID 745369) has the molecular formula C17H25ClN2O and a molecular weight of 308.85 g/mol. Its IUPAC name is 3-chloro-4-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide.
| Compound Name | 3-chloro-4-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 745369 |
| Molecular Formula | C17H25ClN2O |
| Molecular Weight | 308.85 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 3-chloro-4-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide |
| SMILES | Cc1ccc(C(=O)NC2CC(C)(C)NC(C)(C)C2)cc1Cl |
| InChI | InChI=1S/C17H25ClN2O/c1-11-6-7-12(8-14(11)18)15(21)19-13-9-16(2,3)20-17(4,5)10-13/h6-8,13,20H,9-10H2,1-5H3,(H,19,21) |
| InChIKey | HJWSXRVLIXWFPV-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.85 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |