C25H25F3N4O — CID 74538658
N-methyl-7-[3-[4-(piperazin-1-ylmethyl)-3-(trifluoromethyl)phenoxy]prop-1-ynyl]isoquinolin-3-amine (PubChem CID 74538658) has the molecular formula C25H25F3N4O and a molecular weight of 454.50 g/mol. Its IUPAC name is N-methyl-7-[3-[4-(piperazin-1-ylmethyl)-3-(trifluoromethyl)phenoxy]prop-1-ynyl]isoquinolin-3-amine.
| Compound Name | N-methyl-7-[3-[4-(piperazin-1-ylmethyl)-3-(trifluoromethyl)phenoxy]prop-1-ynyl]isoquinolin-3-amine |
|---|---|
| PubChem CID | 74538658 |
| Molecular Formula | C25H25F3N4O |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | N-methyl-7-[3-[4-(piperazin-1-ylmethyl)-3-(trifluoromethyl)phenoxy]prop-1-ynyl]isoquinolin-3-amine |
| SMILES | CNc1cc2ccc(C#CCOc3ccc(CN4CCNCC4)c(C(F)(F)F)c3)cc2cn1 |
| InChI | InChI=1S/C25H25F3N4O/c1-29-24-14-19-5-4-18(13-21(19)16-31-24)3-2-12-33-22-7-6-20(23(15-22)25(26,27)28)17-32-10-8-30-9-11-32/h4-7,13-16,30H,8-12,17H2,1H3,(H,29,31) |
| InChIKey | FTDWSWREBGYXDZ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 49.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|