About 4-[2-methyl-4-[[(1S,2S)-2-quinolin-2-ylcyclopropyl]methoxy]pyrimidin-5-yl]benzoic acid
4-[2-methyl-4-[[(1S,2S)-2-quinolin-2-ylcyclopropyl]methoxy]pyrimidin-5-yl]benzoic acid (PubChem CID 74538681) has the molecular formula C25H21N3O3
and a molecular weight of 411.46 g/mol. Its IUPAC name is 4-[2-methyl-4-[[(1S,2S)-2-quinolin-2-ylcyclopropyl]methoxy]pyrimidin-5-yl]benzoic acid.
Molecular Properties
| Compound Name | 4-[2-methyl-4-[[(1S,2S)-2-quinolin-2-ylcyclopropyl]methoxy]pyrimidin-5-yl]benzoic acid |
| PubChem CID | 74538681 |
| Molecular Formula | C25H21N3O3 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 4-[2-methyl-4-[[(1S,2S)-2-quinolin-2-ylcyclopropyl]methoxy]pyrimidin-5-yl]benzoic acid |
| SMILES | Cc1ncc(-c2ccc(C(=O)O)cc2)c(OC[C@H]2C[C@@H]2c2ccc3ccccc3n2)n1 |
| InChI | InChI=1S/C25H21N3O3/c1-15-26-13-21(16-6-8-18(9-7-16)25(29)30)24(27-15)31-14-19-12-20(19)23-11-10-17-4-2-3-5-22(17)28-23/h2-11,13,19-20H,12,14H2,1H3,(H,29,30)/t19-,20+/m1/s1 |
| InChIKey | WVUZDNLIELSVPJ-UXHICEINSA-N |
| XLogP | 4.88 |
| TPSA | 85.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[2-methyl-4-[[(1S,2S)-2-quinolin-2-ylcyclopropyl]methoxy]pyrimidin-5-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-methyl-4-[[(1S,2S)-2-quinolin-2-ylcyclopropyl]methoxy]pyrimidin-5-yl]benzoic acid?
The IUPAC name of 4-[2-methyl-4-[[(1S,2S)-2-quinolin-2-ylcyclopropyl]methoxy]pyrimidin-5-yl]benzoic acid (CID 74538681) is 4-[2-methyl-4-[[(1S,2S)-2-quinolin-2-ylcyclopropyl]methoxy]pyrimidin-5-yl]benzoic acid.
What is the SMILES notation for 4-[2-methyl-4-[[(1S,2S)-2-quinolin-2-ylcyclopropyl]methoxy]pyrimidin-5-yl]benzoic acid?
The canonical SMILES for 4-[2-methyl-4-[[(1S,2S)-2-quinolin-2-ylcyclopropyl]methoxy]pyrimidin-5-yl]benzoic acid is Cc1ncc(-c2ccc(C(=O)O)cc2)c(OC[C@H]2C[C@@H]2c2ccc3ccccc3n2)n1.
What is the InChIKey of 4-[2-methyl-4-[[(1S,2S)-2-quinolin-2-ylcyclopropyl]methoxy]pyrimidin-5-yl]benzoic acid?
The InChIKey is WVUZDNLIELSVPJ-UXHICEINSA-N. The full InChI is InChI=1S/C25H21N3O3/c1-15-26-13-21(16-6-8-18(9-7-16)25(29)30)24(27-15)31-14-19-12-20(19)23-11-10-17-4-2-3-5-22(17)28-23/h2-11,13,19-20H,12,14H2,1H3,(H,29,30)/t19-,20+/m1/s1.
What are the key properties of 4-[2-methyl-4-[[(1S,2S)-2-quinolin-2-ylcyclopropyl]methoxy]pyrimidin-5-yl]benzoic acid?
4-[2-methyl-4-[[(1S,2S)-2-quinolin-2-ylcyclopropyl]methoxy]pyrimidin-5-yl]benzoic acid has a molecular weight of 411.46 g/mol, XLogP of 4.88, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-methyl-4-[[(1S,2S)-2-quinolin-2-ylcyclopropyl]methoxy]pyrimidin-5-yl]benzoic acid is sourced from PubChem (CID 74538681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).