About 1-ethyl-6,7-dimethoxy-4-(quinolin-3-ylmethyl)isoquinoline
1-ethyl-6,7-dimethoxy-4-(quinolin-3-ylmethyl)isoquinoline (PubChem CID 74539265) has the molecular formula C23H22N2O2
and a molecular weight of 358.44 g/mol. Its IUPAC name is 1-ethyl-6,7-dimethoxy-4-(quinolin-3-ylmethyl)isoquinoline.
Molecular Properties
| Compound Name | 1-ethyl-6,7-dimethoxy-4-(quinolin-3-ylmethyl)isoquinoline |
| PubChem CID | 74539265 |
| Molecular Formula | C23H22N2O2 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 1-ethyl-6,7-dimethoxy-4-(quinolin-3-ylmethyl)isoquinoline |
| SMILES | CCc1ncc(Cc2cnc3ccccc3c2)c2cc(OC)c(OC)cc12 |
| InChI | InChI=1S/C23H22N2O2/c1-4-20-19-12-23(27-3)22(26-2)11-18(19)17(14-25-20)10-15-9-16-7-5-6-8-21(16)24-13-15/h5-9,11-14H,4,10H2,1-3H3 |
| InChIKey | QMZYGDUGQNRMTH-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-ethyl-6,7-dimethoxy-4-(quinolin-3-ylmethyl)isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-6,7-dimethoxy-4-(quinolin-3-ylmethyl)isoquinoline?
The IUPAC name of 1-ethyl-6,7-dimethoxy-4-(quinolin-3-ylmethyl)isoquinoline (CID 74539265) is 1-ethyl-6,7-dimethoxy-4-(quinolin-3-ylmethyl)isoquinoline.
What is the SMILES notation for 1-ethyl-6,7-dimethoxy-4-(quinolin-3-ylmethyl)isoquinoline?
The canonical SMILES for 1-ethyl-6,7-dimethoxy-4-(quinolin-3-ylmethyl)isoquinoline is CCc1ncc(Cc2cnc3ccccc3c2)c2cc(OC)c(OC)cc12.
What is the InChIKey of 1-ethyl-6,7-dimethoxy-4-(quinolin-3-ylmethyl)isoquinoline?
The InChIKey is QMZYGDUGQNRMTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22N2O2/c1-4-20-19-12-23(27-3)22(26-2)11-18(19)17(14-25-20)10-15-9-16-7-5-6-8-21(16)24-13-15/h5-9,11-14H,4,10H2,1-3H3.
What are the key properties of 1-ethyl-6,7-dimethoxy-4-(quinolin-3-ylmethyl)isoquinoline?
1-ethyl-6,7-dimethoxy-4-(quinolin-3-ylmethyl)isoquinoline has a molecular weight of 358.44 g/mol, XLogP of 4.95, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-6,7-dimethoxy-4-(quinolin-3-ylmethyl)isoquinoline is sourced from PubChem (CID 74539265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).