About 4-(3H-benzimidazol-5-ylmethyl)-6,7-dimethoxyisoquinoline
4-(3H-benzimidazol-5-ylmethyl)-6,7-dimethoxyisoquinoline (PubChem CID 74539482) has the molecular formula C19H17N3O2
and a molecular weight of 319.36 g/mol. Its IUPAC name is 4-(3H-benzimidazol-5-ylmethyl)-6,7-dimethoxyisoquinoline.
Molecular Properties
| Compound Name | 4-(3H-benzimidazol-5-ylmethyl)-6,7-dimethoxyisoquinoline |
| PubChem CID | 74539482 |
| Molecular Formula | C19H17N3O2 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 4-(3H-benzimidazol-5-ylmethyl)-6,7-dimethoxyisoquinoline |
| SMILES | COc1cc2cncc(Cc3ccc4nc[nH]c4c3)c2cc1OC |
| InChI | InChI=1S/C19H17N3O2/c1-23-18-7-14-10-20-9-13(15(14)8-19(18)24-2)5-12-3-4-16-17(6-12)22-11-21-16/h3-4,6-11H,5H2,1-2H3,(H,21,22) |
| InChIKey | DUQMPPVJCAQFSZ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(3H-benzimidazol-5-ylmethyl)-6,7-dimethoxyisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3H-benzimidazol-5-ylmethyl)-6,7-dimethoxyisoquinoline?
The IUPAC name of 4-(3H-benzimidazol-5-ylmethyl)-6,7-dimethoxyisoquinoline (CID 74539482) is 4-(3H-benzimidazol-5-ylmethyl)-6,7-dimethoxyisoquinoline.
What is the SMILES notation for 4-(3H-benzimidazol-5-ylmethyl)-6,7-dimethoxyisoquinoline?
The canonical SMILES for 4-(3H-benzimidazol-5-ylmethyl)-6,7-dimethoxyisoquinoline is COc1cc2cncc(Cc3ccc4nc[nH]c4c3)c2cc1OC.
What is the InChIKey of 4-(3H-benzimidazol-5-ylmethyl)-6,7-dimethoxyisoquinoline?
The InChIKey is DUQMPPVJCAQFSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N3O2/c1-23-18-7-14-10-20-9-13(15(14)8-19(18)24-2)5-12-3-4-16-17(6-12)22-11-21-16/h3-4,6-11H,5H2,1-2H3,(H,21,22).
What are the key properties of 4-(3H-benzimidazol-5-ylmethyl)-6,7-dimethoxyisoquinoline?
4-(3H-benzimidazol-5-ylmethyl)-6,7-dimethoxyisoquinoline has a molecular weight of 319.36 g/mol, XLogP of 3.72, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3H-benzimidazol-5-ylmethyl)-6,7-dimethoxyisoquinoline is sourced from PubChem (CID 74539482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).