C26H25F6NO3 — CID 74539526
2-[[3-fluoro-8-[(2,3,4,5,6-pentafluorophenyl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]methyl]-5,6-dimethoxy-2,3-dihydroinden-1-one (PubChem CID 74539526) has the molecular formula C26H25F6NO3 and a molecular weight of 513.48 g/mol. Its IUPAC name is 2-[[3-fluoro-8-[(2,3,4,5,6-pentafluorophenyl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]methyl]-5,6-dimethoxy-2,3-dihydroinden-1-one.
| Compound Name | 2-[[3-fluoro-8-[(2,3,4,5,6-pentafluorophenyl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]methyl]-5,6-dimethoxy-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 74539526 |
| Molecular Formula | C26H25F6NO3 |
| Molecular Weight | 513.48 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | 2-[[3-fluoro-8-[(2,3,4,5,6-pentafluorophenyl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]methyl]-5,6-dimethoxy-2,3-dihydroinden-1-one |
| SMILES | COc1cc2c(cc1OC)C(=O)C(CC1(F)CC3CCC(C1)N3Cc1c(F)c(F)c(F)c(F)c1F)C2 |
| InChI | InChI=1S/C26H25F6NO3/c1-35-18-6-12-5-13(25(34)16(12)7-19(18)36-2)8-26(32)9-14-3-4-15(10-26)33(14)11-17-20(27)22(29)24(31)23(30)21(17)28/h6-7,13-15H,3-5,8-11H2,1-2H3 |
| InChIKey | ZWSRCPRBYBCAHD-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.48 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|