C24H26N4O4S — CID 74539871
6,7-dimethoxy-1-propyl-4-[[8-(sulfamoylamino)quinolin-2-yl]methyl]isoquinoline (PubChem CID 74539871) has the molecular formula C24H26N4O4S and a molecular weight of 466.56 g/mol. Its IUPAC name is 6,7-dimethoxy-1-propyl-4-[[8-(sulfamoylamino)quinolin-2-yl]methyl]isoquinoline.
| Compound Name | 6,7-dimethoxy-1-propyl-4-[[8-(sulfamoylamino)quinolin-2-yl]methyl]isoquinoline |
|---|---|
| PubChem CID | 74539871 |
| Molecular Formula | C24H26N4O4S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | 6,7-dimethoxy-1-propyl-4-[[8-(sulfamoylamino)quinolin-2-yl]methyl]isoquinoline |
| SMILES | CCCc1ncc(Cc2ccc3cccc(NS(N)(=O)=O)c3n2)c2cc(OC)c(OC)cc12 |
| InChI | InChI=1S/C24H26N4O4S/c1-4-6-20-19-13-23(32-3)22(31-2)12-18(19)16(14-26-20)11-17-10-9-15-7-5-8-21(24(15)27-17)28-33(25,29)30/h5,7-10,12-14,28H,4,6,11H2,1-3H3,(H2,25,29,30) |
| InChIKey | GZCPUOWNWGIHSN-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 116.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |