C15H13ClNO4S- — CID 7454068
2-[N-(benzenesulfonyl)-5-chloro-2-methylanilino]acetate (PubChem CID 7454068) has the molecular formula C15H13ClNO4S- and a molecular weight of 338.79 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-5-chloro-2-methylanilino]acetate.
| Compound Name | 2-[N-(benzenesulfonyl)-5-chloro-2-methylanilino]acetate |
|---|---|
| PubChem CID | 7454068 |
| Molecular Formula | C15H13ClNO4S- |
| Molecular Weight | 338.79 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-5-chloro-2-methylanilino]acetate |
| SMILES | Cc1ccc(Cl)cc1N(CC(=O)[O-])S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H14ClNO4S/c1-11-7-8-12(16)9-14(11)17(10-15(18)19)22(20,21)13-5-3-2-4-6-13/h2-9H,10H2,1H3,(H,18,19)/p-1 |
| InChIKey | HFKRSYTYDIXJAO-UHFFFAOYSA-M |
| XLogP | 1.59 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.79 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |