C19H27FN4O2 — CID 74540860
N-ethyl-N-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide (PubChem CID 74540860) has the molecular formula C19H27FN4O2 and a molecular weight of 362.45 g/mol. Its IUPAC name is N-ethyl-N-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide.
| Compound Name | N-ethyl-N-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 74540860 |
| Molecular Formula | C19H27FN4O2 |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | N-ethyl-N-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide |
| SMILES | CCN(CC(=O)NCc1ccc(F)cc1)C(=O)C1NNC2CCCCC21 |
| InChI | InChI=1S/C19H27FN4O2/c1-2-24(12-17(25)21-11-13-7-9-14(20)10-8-13)19(26)18-15-5-3-4-6-16(15)22-23-18/h7-10,15-16,18,22-23H,2-6,11-12H2,1H3,(H,21,25) |
| InChIKey | IKAAQBSBAQLUTG-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |