C17H28NO2+ — CID 7454705
[(1S,2S,3S)-2,3-dimethylcyclohexyl]-[2-(4-methoxyphenoxy)ethyl]azanium (PubChem CID 7454705) has the molecular formula C17H28NO2+ and a molecular weight of 278.42 g/mol. Its IUPAC name is [(1S,2S,3S)-2,3-dimethylcyclohexyl]-[2-(4-methoxyphenoxy)ethyl]azanium.
| Compound Name | [(1S,2S,3S)-2,3-dimethylcyclohexyl]-[2-(4-methoxyphenoxy)ethyl]azanium |
|---|---|
| PubChem CID | 7454705 |
| Molecular Formula | C17H28NO2+ |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | [(1S,2S,3S)-2,3-dimethylcyclohexyl]-[2-(4-methoxyphenoxy)ethyl]azanium |
| SMILES | COc1ccc(OCC[NH2+][C@H]2CCC[C@H](C)[C@@H]2C)cc1 |
| InChI | InChI=1S/C17H27NO2/c1-13-5-4-6-17(14(13)2)18-11-12-20-16-9-7-15(19-3)8-10-16/h7-10,13-14,17-18H,4-6,11-12H2,1-3H3/p+1/t13-,14-,17-/m0/s1 |
| InChIKey | MPRONTYUTNVFNX-ZQIUZPCESA-O |
| XLogP | 2.46 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|