C22H35N5O2 — CID 74551814
ethyl 4-[[3-(4-phenylpiperazin-1-yl)piperidin-1-yl]methyl]pyrazolidine-3-carboxylate (PubChem CID 74551814) has the molecular formula C22H35N5O2 and a molecular weight of 401.56 g/mol. Its IUPAC name is ethyl 4-[[3-(4-phenylpiperazin-1-yl)piperidin-1-yl]methyl]pyrazolidine-3-carboxylate.
| Compound Name | ethyl 4-[[3-(4-phenylpiperazin-1-yl)piperidin-1-yl]methyl]pyrazolidine-3-carboxylate |
|---|---|
| PubChem CID | 74551814 |
| Molecular Formula | C22H35N5O2 |
| Molecular Weight | 401.56 g/mol |
| Exact Mass | 401.28 |
| IUPAC Name | ethyl 4-[[3-(4-phenylpiperazin-1-yl)piperidin-1-yl]methyl]pyrazolidine-3-carboxylate |
| SMILES | CCOC(=O)C1NNCC1CN1CCCC(N2CCN(c3ccccc3)CC2)C1 |
| InChI | InChI=1S/C22H35N5O2/c1-2-29-22(28)21-18(15-23-24-21)16-25-10-6-9-20(17-25)27-13-11-26(12-14-27)19-7-4-3-5-8-19/h3-5,7-8,18,20-21,23-24H,2,6,9-17H2,1H3 |
| InChIKey | QNNXAOMIRGGAPC-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.56 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |