About 3-(2-oxo-1,3-benzothiazol-3-yl)-N-[2-(4-sulfamoylphenyl)ethyl]propanamide
3-(2-oxo-1,3-benzothiazol-3-yl)-N-[2-(4-sulfamoylphenyl)ethyl]propanamide (PubChem CID 7455252) has the molecular formula C18H19N3O4S2
and a molecular weight of 405.50 g/mol. Its IUPAC name is 3-(2-oxo-1,3-benzothiazol-3-yl)-N-[2-(4-sulfamoylphenyl)ethyl]propanamide.
Molecular Properties
| Compound Name | 3-(2-oxo-1,3-benzothiazol-3-yl)-N-[2-(4-sulfamoylphenyl)ethyl]propanamide |
| PubChem CID | 7455252 |
| Molecular Formula | C18H19N3O4S2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | 3-(2-oxo-1,3-benzothiazol-3-yl)-N-[2-(4-sulfamoylphenyl)ethyl]propanamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)CCn2c(=O)sc3ccccc32)cc1 |
| InChI | InChI=1S/C18H19N3O4S2/c19-27(24,25)14-7-5-13(6-8-14)9-11-20-17(22)10-12-21-15-3-1-2-4-16(15)26-18(21)23/h1-8H,9-12H2,(H,20,22)(H2,19,24,25) |
| InChIKey | RIHWZHXARQUBJF-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 111.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(2-oxo-1,3-benzothiazol-3-yl)-N-[2-(4-sulfamoylphenyl)ethyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-oxo-1,3-benzothiazol-3-yl)-N-[2-(4-sulfamoylphenyl)ethyl]propanamide?
The IUPAC name of 3-(2-oxo-1,3-benzothiazol-3-yl)-N-[2-(4-sulfamoylphenyl)ethyl]propanamide (CID 7455252) is 3-(2-oxo-1,3-benzothiazol-3-yl)-N-[2-(4-sulfamoylphenyl)ethyl]propanamide.
What is the SMILES notation for 3-(2-oxo-1,3-benzothiazol-3-yl)-N-[2-(4-sulfamoylphenyl)ethyl]propanamide?
The canonical SMILES for 3-(2-oxo-1,3-benzothiazol-3-yl)-N-[2-(4-sulfamoylphenyl)ethyl]propanamide is NS(=O)(=O)c1ccc(CCNC(=O)CCn2c(=O)sc3ccccc32)cc1.
What is the InChIKey of 3-(2-oxo-1,3-benzothiazol-3-yl)-N-[2-(4-sulfamoylphenyl)ethyl]propanamide?
The InChIKey is RIHWZHXARQUBJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N3O4S2/c19-27(24,25)14-7-5-13(6-8-14)9-11-20-17(22)10-12-21-15-3-1-2-4-16(15)26-18(21)23/h1-8H,9-12H2,(H,20,22)(H2,19,24,25).
What are the key properties of 3-(2-oxo-1,3-benzothiazol-3-yl)-N-[2-(4-sulfamoylphenyl)ethyl]propanamide?
3-(2-oxo-1,3-benzothiazol-3-yl)-N-[2-(4-sulfamoylphenyl)ethyl]propanamide has a molecular weight of 405.50 g/mol, XLogP of 1.46, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-oxo-1,3-benzothiazol-3-yl)-N-[2-(4-sulfamoylphenyl)ethyl]propanamide is sourced from PubChem (CID 7455252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).