About N'-benzyl-N'-[[3-(4-chlorophenyl)pyrazolidin-4-yl]methyl]-N,N-dimethylethane-1,2-diamine
N'-benzyl-N'-[[3-(4-chlorophenyl)pyrazolidin-4-yl]methyl]-N,N-dimethylethane-1,2-diamine (PubChem CID 74552940) has the molecular formula C21H29ClN4
and a molecular weight of 372.94 g/mol. Its IUPAC name is N'-benzyl-N'-[[3-(4-chlorophenyl)pyrazolidin-4-yl]methyl]-N,N-dimethylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-benzyl-N'-[[3-(4-chlorophenyl)pyrazolidin-4-yl]methyl]-N,N-dimethylethane-1,2-diamine |
| PubChem CID | 74552940 |
| Molecular Formula | C21H29ClN4 |
| Molecular Weight | 372.94 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | N'-benzyl-N'-[[3-(4-chlorophenyl)pyrazolidin-4-yl]methyl]-N,N-dimethylethane-1,2-diamine |
| SMILES | CN(C)CCN(Cc1ccccc1)CC1CNNC1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H29ClN4/c1-25(2)12-13-26(15-17-6-4-3-5-7-17)16-19-14-23-24-21(19)18-8-10-20(22)11-9-18/h3-11,19,21,23-24H,12-16H2,1-2H3 |
| InChIKey | NVJIXVZSGITTNY-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.94 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N'-benzyl-N'-[[3-(4-chlorophenyl)pyrazolidin-4-yl]methyl]-N,N-dimethylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-benzyl-N'-[[3-(4-chlorophenyl)pyrazolidin-4-yl]methyl]-N,N-dimethylethane-1,2-diamine?
The IUPAC name of N'-benzyl-N'-[[3-(4-chlorophenyl)pyrazolidin-4-yl]methyl]-N,N-dimethylethane-1,2-diamine (CID 74552940) is N'-benzyl-N'-[[3-(4-chlorophenyl)pyrazolidin-4-yl]methyl]-N,N-dimethylethane-1,2-diamine.
What is the SMILES notation for N'-benzyl-N'-[[3-(4-chlorophenyl)pyrazolidin-4-yl]methyl]-N,N-dimethylethane-1,2-diamine?
The canonical SMILES for N'-benzyl-N'-[[3-(4-chlorophenyl)pyrazolidin-4-yl]methyl]-N,N-dimethylethane-1,2-diamine is CN(C)CCN(Cc1ccccc1)CC1CNNC1c1ccc(Cl)cc1.
What is the InChIKey of N'-benzyl-N'-[[3-(4-chlorophenyl)pyrazolidin-4-yl]methyl]-N,N-dimethylethane-1,2-diamine?
The InChIKey is NVJIXVZSGITTNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H29ClN4/c1-25(2)12-13-26(15-17-6-4-3-5-7-17)16-19-14-23-24-21(19)18-8-10-20(22)11-9-18/h3-11,19,21,23-24H,12-16H2,1-2H3.
What are the key properties of N'-benzyl-N'-[[3-(4-chlorophenyl)pyrazolidin-4-yl]methyl]-N,N-dimethylethane-1,2-diamine?
N'-benzyl-N'-[[3-(4-chlorophenyl)pyrazolidin-4-yl]methyl]-N,N-dimethylethane-1,2-diamine has a molecular weight of 372.94 g/mol, XLogP of 3.17, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-benzyl-N'-[[3-(4-chlorophenyl)pyrazolidin-4-yl]methyl]-N,N-dimethylethane-1,2-diamine is sourced from PubChem (CID 74552940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).