C15H17FN2O2 — CID 7456009
(3R)-1-cyclopentyl-3-(4-fluoroanilino)pyrrolidine-2,5-dione (PubChem CID 7456009) has the molecular formula C15H17FN2O2 and a molecular weight of 276.31 g/mol. Its IUPAC name is (3R)-1-cyclopentyl-3-(4-fluoroanilino)pyrrolidine-2,5-dione.
| Compound Name | (3R)-1-cyclopentyl-3-(4-fluoroanilino)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 7456009 |
| Molecular Formula | C15H17FN2O2 |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | (3R)-1-cyclopentyl-3-(4-fluoroanilino)pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@@H](Nc2ccc(F)cc2)C(=O)N1C1CCCC1 |
| InChI | InChI=1S/C15H17FN2O2/c16-10-5-7-11(8-6-10)17-13-9-14(19)18(15(13)20)12-3-1-2-4-12/h5-8,12-13,17H,1-4,9H2/t13-/m1/s1 |
| InChIKey | VNSSPYNBMKAINI-CYBMUJFWSA-N |
| XLogP | 2.31 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|