C19H27N3O3 — CID 7456194
(3S)-1-(2-butoxyphenyl)-3-(4-methylpiperazin-1-yl)pyrrolidine-2,5-dione (PubChem CID 7456194) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is (3S)-1-(2-butoxyphenyl)-3-(4-methylpiperazin-1-yl)pyrrolidine-2,5-dione.
| Compound Name | (3S)-1-(2-butoxyphenyl)-3-(4-methylpiperazin-1-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 7456194 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | (3S)-1-(2-butoxyphenyl)-3-(4-methylpiperazin-1-yl)pyrrolidine-2,5-dione |
| SMILES | CCCCOc1ccccc1N1C(=O)C[C@H](N2CCN(C)CC2)C1=O |
| InChI | InChI=1S/C19H27N3O3/c1-3-4-13-25-17-8-6-5-7-15(17)22-18(23)14-16(19(22)24)21-11-9-20(2)10-12-21/h5-8,16H,3-4,9-14H2,1-2H3/t16-/m0/s1 |
| InChIKey | LMXRUHUVZPNJLI-INIZCTEOSA-N |
| XLogP | 1.74 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|