C22H23NO5 — CID 7456949
[2-oxo-2-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]ethyl] 2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetate (PubChem CID 7456949) has the molecular formula C22H23NO5 and a molecular weight of 381.43 g/mol. Its IUPAC name is [2-oxo-2-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]ethyl] 2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetate.
| Compound Name | [2-oxo-2-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]ethyl] 2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetate |
|---|---|
| PubChem CID | 7456949 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | [2-oxo-2-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]ethyl] 2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetate |
| SMILES | O=C(COC(=O)Cc1ccc2c(c1)OCCO2)N[C@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C22H23NO5/c24-21(23-18-7-3-5-16-4-1-2-6-17(16)18)14-28-22(25)13-15-8-9-19-20(12-15)27-11-10-26-19/h1-2,4,6,8-9,12,18H,3,5,7,10-11,13-14H2,(H,23,24)/t18-/m0/s1 |
| InChIKey | LAOAJYPDJNDAJH-SFHVURJKSA-N |
| XLogP | 2.74 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |