C22H32N6O3 — CID 74574042
8-[(4-benzylpiperazin-1-yl)methyl]-7-(2-ethoxyethyl)-3-methyl-4,5-dihydropurine-2,6-dione (PubChem CID 74574042) has the molecular formula C22H32N6O3 and a molecular weight of 428.54 g/mol. Its IUPAC name is 8-[(4-benzylpiperazin-1-yl)methyl]-7-(2-ethoxyethyl)-3-methyl-4,5-dihydropurine-2,6-dione.
| Compound Name | 8-[(4-benzylpiperazin-1-yl)methyl]-7-(2-ethoxyethyl)-3-methyl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 74574042 |
| Molecular Formula | C22H32N6O3 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | 8-[(4-benzylpiperazin-1-yl)methyl]-7-(2-ethoxyethyl)-3-methyl-4,5-dihydropurine-2,6-dione |
| SMILES | CCOCCN1C(CN2CCN(Cc3ccccc3)CC2)=NC2C1C(=O)NC(=O)N2C |
| InChI | InChI=1S/C22H32N6O3/c1-3-31-14-13-28-18(23-20-19(28)21(29)24-22(30)25(20)2)16-27-11-9-26(10-12-27)15-17-7-5-4-6-8-17/h4-8,19-20H,3,9-16H2,1-2H3,(H,24,29,30) |
| InChIKey | NVURUEADULETFY-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 80.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|