C28H38N2O4S — CID 74578543
N-[8-hydroxy-1,4a-dimethyl-7-[1-oxo-1-(thiophen-2-ylmethylamino)propan-2-yl]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-4-methoxybenzamide (PubChem CID 74578543) has the molecular formula C28H38N2O4S and a molecular weight of 498.69 g/mol. Its IUPAC name is N-[8-hydroxy-1,4a-dimethyl-7-[1-oxo-1-(thiophen-2-ylmethylamino)propan-2-yl]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-4-methoxybenzamide.
| Compound Name | N-[8-hydroxy-1,4a-dimethyl-7-[1-oxo-1-(thiophen-2-ylmethylamino)propan-2-yl]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 74578543 |
| Molecular Formula | C28H38N2O4S |
| Molecular Weight | 498.69 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | N-[8-hydroxy-1,4a-dimethyl-7-[1-oxo-1-(thiophen-2-ylmethylamino)propan-2-yl]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NC2CCC3(C)CCC(C(C)C(=O)NCc4cccs4)C(O)C3C2C)cc1 |
| InChI | InChI=1S/C28H38N2O4S/c1-17(26(32)29-16-21-6-5-15-35-21)22-11-13-28(3)14-12-23(18(2)24(28)25(22)31)30-27(33)19-7-9-20(34-4)10-8-19/h5-10,15,17-18,22-25,31H,11-14,16H2,1-4H3,(H,29,32)(H,30,33) |
| InChIKey | OKVYVQHCLCSBBT-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.69 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |