C27H35ClN4O3 — CID 74578671
N-[7-[1-[(2-chlorophenyl)methylamino]-1-oxopropan-2-yl]-8-hydroxy-1,4a-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]pyrazine-2-carboxamide (PubChem CID 74578671) has the molecular formula C27H35ClN4O3 and a molecular weight of 499.06 g/mol. Its IUPAC name is N-[7-[1-[(2-chlorophenyl)methylamino]-1-oxopropan-2-yl]-8-hydroxy-1,4a-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]pyrazine-2-carboxamide.
| Compound Name | N-[7-[1-[(2-chlorophenyl)methylamino]-1-oxopropan-2-yl]-8-hydroxy-1,4a-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 74578671 |
| Molecular Formula | C27H35ClN4O3 |
| Molecular Weight | 499.06 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | N-[7-[1-[(2-chlorophenyl)methylamino]-1-oxopropan-2-yl]-8-hydroxy-1,4a-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]pyrazine-2-carboxamide |
| SMILES | CC(C(=O)NCc1ccccc1Cl)C1CCC2(C)CCC(NC(=O)c3cnccn3)C(C)C2C1O |
| InChI | InChI=1S/C27H35ClN4O3/c1-16(25(34)31-14-18-6-4-5-7-20(18)28)19-8-10-27(3)11-9-21(17(2)23(27)24(19)33)32-26(35)22-15-29-12-13-30-22/h4-7,12-13,15-17,19,21,23-24,33H,8-11,14H2,1-3H3,(H,31,34)(H,32,35) |
| InChIKey | FSLFDLLBZPVIIG-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.06 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |