C23H30N6O4S — CID 74579785
4,5-dihydroxy-N-(2-morpholin-4-ylethyl)-2-(4-pyrazol-1-ylanilino)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide (PubChem CID 74579785) has the molecular formula C23H30N6O4S and a molecular weight of 486.60 g/mol. Its IUPAC name is 4,5-dihydroxy-N-(2-morpholin-4-ylethyl)-2-(4-pyrazol-1-ylanilino)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide.
| Compound Name | 4,5-dihydroxy-N-(2-morpholin-4-ylethyl)-2-(4-pyrazol-1-ylanilino)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide |
|---|---|
| PubChem CID | 74579785 |
| Molecular Formula | C23H30N6O4S |
| Molecular Weight | 486.60 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | 4,5-dihydroxy-N-(2-morpholin-4-ylethyl)-2-(4-pyrazol-1-ylanilino)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide |
| SMILES | O=C(NCCN1CCOCC1)C1CC(O)C(O)C2N=C(Nc3ccc(-n4cccn4)cc3)SC12 |
| InChI | InChI=1S/C23H30N6O4S/c30-18-14-17(22(32)24-7-9-28-10-12-33-13-11-28)21-19(20(18)31)27-23(34-21)26-15-2-4-16(5-3-15)29-8-1-6-25-29/h1-6,8,17-21,30-31H,7,9-14H2,(H,24,32)(H,26,27) |
| InChIKey | JOMFDPOEKXWKPW-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 124.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.60 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |