C21H22F2N6 — CID 74579979
3-(2,3-difluorophenyl)-5-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]-1,2,3,3a,4,6,7,7a-octahydropyrazolo[4,3-c]pyridine (PubChem CID 74579979) has the molecular formula C21H22F2N6 and a molecular weight of 396.45 g/mol. Its IUPAC name is 3-(2,3-difluorophenyl)-5-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]-1,2,3,3a,4,6,7,7a-octahydropyrazolo[4,3-c]pyridine.
| Compound Name | 3-(2,3-difluorophenyl)-5-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]-1,2,3,3a,4,6,7,7a-octahydropyrazolo[4,3-c]pyridine |
|---|---|
| PubChem CID | 74579979 |
| Molecular Formula | C21H22F2N6 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | 3-(2,3-difluorophenyl)-5-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]-1,2,3,3a,4,6,7,7a-octahydropyrazolo[4,3-c]pyridine |
| SMILES | Fc1cccc(C2NNC3CCN(Cc4ccc(-n5cncn5)cc4)CC32)c1F |
| InChI | InChI=1S/C21H22F2N6/c22-18-3-1-2-16(20(18)23)21-17-11-28(9-8-19(17)26-27-21)10-14-4-6-15(7-5-14)29-13-24-12-25-29/h1-7,12-13,17,19,21,26-27H,8-11H2 |
| InChIKey | HFIPNNRZUBWCFS-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 58.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |