C17H29N5O2 — CID 74583616
(3-heptan-4-yl-1,2,3,3a,4,6,7,7a-octahydropyrazolo[4,3-c]pyridin-5-yl)-(4-methyl-1,2,5-oxadiazol-3-yl)methanone (PubChem CID 74583616) has the molecular formula C17H29N5O2 and a molecular weight of 335.45 g/mol. Its IUPAC name is (3-heptan-4-yl-1,2,3,3a,4,6,7,7a-octahydropyrazolo[4,3-c]pyridin-5-yl)-(4-methyl-1,2,5-oxadiazol-3-yl)methanone.
| Compound Name | (3-heptan-4-yl-1,2,3,3a,4,6,7,7a-octahydropyrazolo[4,3-c]pyridin-5-yl)-(4-methyl-1,2,5-oxadiazol-3-yl)methanone |
|---|---|
| PubChem CID | 74583616 |
| Molecular Formula | C17H29N5O2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.23 |
| IUPAC Name | (3-heptan-4-yl-1,2,3,3a,4,6,7,7a-octahydropyrazolo[4,3-c]pyridin-5-yl)-(4-methyl-1,2,5-oxadiazol-3-yl)methanone |
| SMILES | CCCC(CCC)C1NNC2CCN(C(=O)c3nonc3C)CC21 |
| InChI | InChI=1S/C17H29N5O2/c1-4-6-12(7-5-2)16-13-10-22(9-8-14(13)18-19-16)17(23)15-11(3)20-24-21-15/h12-14,16,18-19H,4-10H2,1-3H3 |
| InChIKey | XTOLCCDKEXMMTC-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 83.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |