C29H34N2O4 — CID 74587851
9-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-3-(2-methoxyphenyl)-2-methyl-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-4-one (PubChem CID 74587851) has the molecular formula C29H34N2O4 and a molecular weight of 474.60 g/mol. Its IUPAC name is 9-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-3-(2-methoxyphenyl)-2-methyl-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-4-one.
| Compound Name | 9-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-3-(2-methoxyphenyl)-2-methyl-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-4-one |
|---|---|
| PubChem CID | 74587851 |
| Molecular Formula | C29H34N2O4 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | 9-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-3-(2-methoxyphenyl)-2-methyl-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-4-one |
| SMILES | COc1ccccc1-c1c(C)oc2c3c(ccc2c1=O)OCN(CC1CCCN2CCCCC12)C3 |
| InChI | InChI=1S/C29H34N2O4/c1-19-27(21-9-3-4-11-25(21)33-2)28(32)22-12-13-26-23(29(22)35-19)17-30(18-34-26)16-20-8-7-15-31-14-6-5-10-24(20)31/h3-4,9,11-13,20,24H,5-8,10,14-18H2,1-2H3 |
| InChIKey | QSUZPFPANNDICT-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 55.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |