C29H34N2O5 — CID 74587901
9-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-3-(2,4-dimethoxyphenyl)-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one (PubChem CID 74587901) has the molecular formula C29H34N2O5 and a molecular weight of 490.60 g/mol. Its IUPAC name is 9-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-3-(2,4-dimethoxyphenyl)-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one.
| Compound Name | 9-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-3-(2,4-dimethoxyphenyl)-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one |
|---|---|
| PubChem CID | 74587901 |
| Molecular Formula | C29H34N2O5 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | 9-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-3-(2,4-dimethoxyphenyl)-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one |
| SMILES | COc1ccc(-c2cc3ccc4c(c3oc2=O)CN(CC2CCCN3CCCCC23)CO4)c(OC)c1 |
| InChI | InChI=1S/C29H34N2O5/c1-33-21-9-10-22(27(15-21)34-2)23-14-19-8-11-26-24(28(19)36-29(23)32)17-30(18-35-26)16-20-6-5-13-31-12-4-3-7-25(20)31/h8-11,14-15,20,25H,3-7,12-13,16-18H2,1-2H3 |
| InChIKey | LVPHRICAQHKGBX-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 64.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|