C26H25N5O — CID 7459680
N,N-diethyl-4-[2-(4-methoxyphenyl)imidazo[4,5-b]quinoxalin-3-yl]aniline (PubChem CID 7459680) has the molecular formula C26H25N5O and a molecular weight of 423.52 g/mol. Its IUPAC name is N,N-diethyl-4-[2-(4-methoxyphenyl)imidazo[4,5-b]quinoxalin-3-yl]aniline.
| Compound Name | N,N-diethyl-4-[2-(4-methoxyphenyl)imidazo[4,5-b]quinoxalin-3-yl]aniline |
|---|---|
| PubChem CID | 7459680 |
| Molecular Formula | C26H25N5O |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | N,N-diethyl-4-[2-(4-methoxyphenyl)imidazo[4,5-b]quinoxalin-3-yl]aniline |
| SMILES | CCN(CC)c1ccc(-n2c(-c3ccc(OC)cc3)nc3nc4ccccc4nc32)cc1 |
| InChI | InChI=1S/C26H25N5O/c1-4-30(5-2)19-12-14-20(15-13-19)31-25(18-10-16-21(32-3)17-11-18)29-24-26(31)28-23-9-7-6-8-22(23)27-24/h6-17H,4-5H2,1-3H3 |
| InChIKey | DARPFTURKHNIRQ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|