About 4-(2,5-dioxopyrrolidin-1-yl)-N-(1,3-thiazol-2-yl)benzamide
4-(2,5-dioxopyrrolidin-1-yl)-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 746005) has the molecular formula C14H11N3O3S
and a molecular weight of 301.33 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrolidin-1-yl)-N-(1,3-thiazol-2-yl)benzamide.
Molecular Properties
| Compound Name | 4-(2,5-dioxopyrrolidin-1-yl)-N-(1,3-thiazol-2-yl)benzamide |
| PubChem CID | 746005 |
| Molecular Formula | C14H11N3O3S |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 4-(2,5-dioxopyrrolidin-1-yl)-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | O=C(Nc1nccs1)c1ccc(N2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C14H11N3O3S/c18-11-5-6-12(19)17(11)10-3-1-9(2-4-10)13(20)16-14-15-7-8-21-14/h1-4,7-8H,5-6H2,(H,15,16,20) |
| InChIKey | WXECFKGEINUGKU-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,5-dioxopyrrolidin-1-yl)-N-(1,3-thiazol-2-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,5-dioxopyrrolidin-1-yl)-N-(1,3-thiazol-2-yl)benzamide?
The IUPAC name of 4-(2,5-dioxopyrrolidin-1-yl)-N-(1,3-thiazol-2-yl)benzamide (CID 746005) is 4-(2,5-dioxopyrrolidin-1-yl)-N-(1,3-thiazol-2-yl)benzamide.
What is the SMILES notation for 4-(2,5-dioxopyrrolidin-1-yl)-N-(1,3-thiazol-2-yl)benzamide?
The canonical SMILES for 4-(2,5-dioxopyrrolidin-1-yl)-N-(1,3-thiazol-2-yl)benzamide is O=C(Nc1nccs1)c1ccc(N2C(=O)CCC2=O)cc1.
What is the InChIKey of 4-(2,5-dioxopyrrolidin-1-yl)-N-(1,3-thiazol-2-yl)benzamide?
The InChIKey is WXECFKGEINUGKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N3O3S/c18-11-5-6-12(19)17(11)10-3-1-9(2-4-10)13(20)16-14-15-7-8-21-14/h1-4,7-8H,5-6H2,(H,15,16,20).
What are the key properties of 4-(2,5-dioxopyrrolidin-1-yl)-N-(1,3-thiazol-2-yl)benzamide?
4-(2,5-dioxopyrrolidin-1-yl)-N-(1,3-thiazol-2-yl)benzamide has a molecular weight of 301.33 g/mol, XLogP of 2.05, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,5-dioxopyrrolidin-1-yl)-N-(1,3-thiazol-2-yl)benzamide is sourced from PubChem (CID 746005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).