2-(2,2-dimethylpropylideneamino)propanoic acid

C8H15NO2 — CID 74601458

IUPAC2-(2,2-dimethylpropylideneamino)propanoic acid
SMILESCC(/N=C/C(C)(C)C)C(=O)O
InChIInChI=1S/C8H15NO2/c1-6(7(10)11)9-5-8(2,3)4/h5-6H,1-4H3,(H,10,11)/b9-5+
InChIKeyGVEPPKOFQJDAAQ-WEVVVXLNSA-N
MW157.21 g/mol
LogP1.58
Rot. Bonds2

About 2-(2,2-dimethylpropylideneamino)propanoic acid

2-(2,2-dimethylpropylideneamino)propanoic acid (PubChem CID 74601458) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is 2-(2,2-dimethylpropylideneamino)propanoic acid.

Molecular Properties

Compound Name2-(2,2-dimethylpropylideneamino)propanoic acid
PubChem CID74601458
Molecular FormulaC8H15NO2
Molecular Weight157.21 g/mol
Exact Mass157.11
IUPAC Name2-(2,2-dimethylpropylideneamino)propanoic acid
SMILESCC(/N=C/C(C)(C)C)C(=O)O
InChIInChI=1S/C8H15NO2/c1-6(7(10)11)9-5-8(2,3)4/h5-6H,1-4H3,(H,10,11)/b9-5+
InChIKeyGVEPPKOFQJDAAQ-WEVVVXLNSA-N
XLogP1.58
TPSA49.66 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500157.21
LogP ≤ 51.58
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}

Analyze 2-(2,2-dimethylpropylideneamino)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,2-dimethylpropylideneamino)propanoic acid?
The IUPAC name of 2-(2,2-dimethylpropylideneamino)propanoic acid (CID 74601458) is 2-(2,2-dimethylpropylideneamino)propanoic acid.
What is the SMILES notation for 2-(2,2-dimethylpropylideneamino)propanoic acid?
The canonical SMILES for 2-(2,2-dimethylpropylideneamino)propanoic acid is CC(/N=C/C(C)(C)C)C(=O)O.
What is the InChIKey of 2-(2,2-dimethylpropylideneamino)propanoic acid?
The InChIKey is GVEPPKOFQJDAAQ-WEVVVXLNSA-N. The full InChI is InChI=1S/C8H15NO2/c1-6(7(10)11)9-5-8(2,3)4/h5-6H,1-4H3,(H,10,11)/b9-5+.
What are the key properties of 2-(2,2-dimethylpropylideneamino)propanoic acid?
2-(2,2-dimethylpropylideneamino)propanoic acid has a molecular weight of 157.21 g/mol, XLogP of 1.58, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-dimethylpropylideneamino)propanoic acid is sourced from PubChem (CID 74601458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).