C14H20N2O9 — CID 74602640
(5-acetamido-3,4-diacetyloxy-6-hydroxyiminooxan-2-yl)methyl acetate (PubChem CID 74602640) has the molecular formula C14H20N2O9 and a molecular weight of 360.32 g/mol. Its IUPAC name is (5-acetamido-3,4-diacetyloxy-6-hydroxyiminooxan-2-yl)methyl acetate.
| Compound Name | (5-acetamido-3,4-diacetyloxy-6-hydroxyiminooxan-2-yl)methyl acetate |
|---|---|
| PubChem CID | 74602640 |
| Molecular Formula | C14H20N2O9 |
| Molecular Weight | 360.32 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | (5-acetamido-3,4-diacetyloxy-6-hydroxyiminooxan-2-yl)methyl acetate |
| SMILES | CC(=O)NC1C(=NO)OC(COC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C14H20N2O9/c1-6(17)15-11-13(24-9(4)20)12(23-8(3)19)10(5-22-7(2)18)25-14(11)16-21/h10-13,21H,5H2,1-4H3,(H,15,17) |
| InChIKey | QHLGKFLFCWDLOA-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 149.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.32 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|