C16H21N3O8 — CID 74603426
3,4,5-trihydroxy-6-[3-[4-[methyl(nitroso)amino]butanoyl]pyridin-1-ium-1-yl]oxane-2-carboxylate (PubChem CID 74603426) has the molecular formula C16H21N3O8 and a molecular weight of 383.36 g/mol. Its IUPAC name is 3,4,5-trihydroxy-6-[3-[4-[methyl(nitroso)amino]butanoyl]pyridin-1-ium-1-yl]oxane-2-carboxylate.
| Compound Name | 3,4,5-trihydroxy-6-[3-[4-[methyl(nitroso)amino]butanoyl]pyridin-1-ium-1-yl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 74603426 |
| Molecular Formula | C16H21N3O8 |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 3,4,5-trihydroxy-6-[3-[4-[methyl(nitroso)amino]butanoyl]pyridin-1-ium-1-yl]oxane-2-carboxylate |
| SMILES | CN(CCCC(=O)c1ccc[n+](C2OC(C(=O)[O-])C(O)C(O)C2O)c1)N=O |
| InChI | InChI=1S/C16H21N3O8/c1-18(17-26)6-3-5-10(20)9-4-2-7-19(8-9)15-13(23)11(21)12(22)14(27-15)16(24)25/h2,4,7-8,11-15,21-23H,3,5-6H2,1H3 |
| InChIKey | OCZWZVHMLRFHQX-UHFFFAOYSA-N |
| XLogP | -2.72 |
| TPSA | 163.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | -2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|