C16H20N2O — CID 746044
8-N,8-N,10-N,10-N-tetramethyl-3-oxatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaene-8,10-diamine (PubChem CID 746044) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is 8-N,8-N,10-N,10-N-tetramethyl-3-oxatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaene-8,10-diamine.
| Compound Name | 8-N,8-N,10-N,10-N-tetramethyl-3-oxatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaene-8,10-diamine |
|---|---|
| PubChem CID | 746044 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 8-N,8-N,10-N,10-N-tetramethyl-3-oxatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaene-8,10-diamine |
| SMILES | CN(C)c1ccc2c3c(ccc(N(C)C)c13)COC2 |
| InChI | InChI=1S/C16H20N2O/c1-17(2)13-7-5-11-9-19-10-12-6-8-14(18(3)4)16(13)15(11)12/h5-8H,9-10H2,1-4H3 |
| InChIKey | DQIWRQIXCBPXNI-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |