C11H19N4O3+ — CID 7461047
dimethyl-[3-[1-(2,4,6-trioxo-1,3-diazinan-5-yl)ethylideneamino]propyl]azanium (PubChem CID 7461047) has the molecular formula C11H19N4O3+ and a molecular weight of 255.30 g/mol. Its IUPAC name is dimethyl-[3-[1-(2,4,6-trioxo-1,3-diazinan-5-yl)ethylideneamino]propyl]azanium.
| Compound Name | dimethyl-[3-[1-(2,4,6-trioxo-1,3-diazinan-5-yl)ethylideneamino]propyl]azanium |
|---|---|
| PubChem CID | 7461047 |
| Molecular Formula | C11H19N4O3+ |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | dimethyl-[3-[1-(2,4,6-trioxo-1,3-diazinan-5-yl)ethylideneamino]propyl]azanium |
| SMILES | C/C(=N\CCC[NH+](C)C)C1C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C11H18N4O3/c1-7(12-5-4-6-15(2)3)8-9(16)13-11(18)14-10(8)17/h8H,4-6H2,1-3H3,(H2,13,14,16,17,18)/p+1/b12-7+ |
| InChIKey | FHHGKMRIJRFJMQ-KPKJPENVSA-O |
| XLogP | -2.04 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|