C18H24FN4O3+ — CID 7461090
diethyl-[2-[[1-[(4-fluorophenyl)methyl]-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]ethyl]azanium (PubChem CID 7461090) has the molecular formula C18H24FN4O3+ and a molecular weight of 363.41 g/mol. Its IUPAC name is diethyl-[2-[[1-[(4-fluorophenyl)methyl]-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]ethyl]azanium.
| Compound Name | diethyl-[2-[[1-[(4-fluorophenyl)methyl]-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]ethyl]azanium |
|---|---|
| PubChem CID | 7461090 |
| Molecular Formula | C18H24FN4O3+ |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | diethyl-[2-[[1-[(4-fluorophenyl)methyl]-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]ethyl]azanium |
| SMILES | CC[NH+](CC)CC/N=C/C1C(=O)NC(=O)N(Cc2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C18H23FN4O3/c1-3-22(4-2)10-9-20-11-15-16(24)21-18(26)23(17(15)25)12-13-5-7-14(19)8-6-13/h5-8,11,15H,3-4,9-10,12H2,1-2H3,(H,21,24,26)/p+1/b20-11+ |
| InChIKey | GVEZVCQLIWHAHH-RGVLZGJSSA-O |
| XLogP | 0.02 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|