C12H17N5O2 — CID 74611271
2-oxo-N-(1H-1,2,4-triazol-5-yl)-3,4,4a,5,6,7,8,8a-octahydro-1H-quinoline-4-carboxamide (PubChem CID 74611271) has the molecular formula C12H17N5O2 and a molecular weight of 263.30 g/mol. Its IUPAC name is 2-oxo-N-(1H-1,2,4-triazol-5-yl)-3,4,4a,5,6,7,8,8a-octahydro-1H-quinoline-4-carboxamide.
| Compound Name | 2-oxo-N-(1H-1,2,4-triazol-5-yl)-3,4,4a,5,6,7,8,8a-octahydro-1H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 74611271 |
| Molecular Formula | C12H17N5O2 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 2-oxo-N-(1H-1,2,4-triazol-5-yl)-3,4,4a,5,6,7,8,8a-octahydro-1H-quinoline-4-carboxamide |
| SMILES | O=C1CC(C(=O)Nc2ncn[nH]2)C2CCCCC2N1 |
| InChI | InChI=1S/C12H17N5O2/c18-10-5-8(7-3-1-2-4-9(7)15-10)11(19)16-12-13-6-14-17-12/h6-9H,1-5H2,(H,15,18)(H2,13,14,16,17,19) |
| InChIKey | GUDSIUQGKOAKHK-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |