C19H19N3O4 — CID 7461133
1-benzyl-5-[C-ethyl-N-(furan-2-ylmethyl)carbonimidoyl]-1,3-diazinane-2,4,6-trione (PubChem CID 7461133) has the molecular formula C19H19N3O4 and a molecular weight of 353.38 g/mol. Its IUPAC name is 1-benzyl-5-[C-ethyl-N-(furan-2-ylmethyl)carbonimidoyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-benzyl-5-[C-ethyl-N-(furan-2-ylmethyl)carbonimidoyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 7461133 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 1-benzyl-5-[C-ethyl-N-(furan-2-ylmethyl)carbonimidoyl]-1,3-diazinane-2,4,6-trione |
| SMILES | CC/C(=N\Cc1ccco1)C1C(=O)NC(=O)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C19H19N3O4/c1-2-15(20-11-14-9-6-10-26-14)16-17(23)21-19(25)22(18(16)24)12-13-7-4-3-5-8-13/h3-10,16H,2,11-12H2,1H3,(H,21,23,25)/b20-15+ |
| InChIKey | YAEGFKKVWFCLQI-HMMYKYKNSA-N |
| XLogP | 2.53 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|