C19H30N4O4 — CID 7461546
1-cyclohexyl-5-[C-methyl-N-(3-morpholin-4-ylpropyl)carbonimidoyl]-1,3-diazinane-2,4,6-trione (PubChem CID 7461546) has the molecular formula C19H30N4O4 and a molecular weight of 378.47 g/mol. Its IUPAC name is 1-cyclohexyl-5-[C-methyl-N-(3-morpholin-4-ylpropyl)carbonimidoyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-cyclohexyl-5-[C-methyl-N-(3-morpholin-4-ylpropyl)carbonimidoyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 7461546 |
| Molecular Formula | C19H30N4O4 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | 1-cyclohexyl-5-[C-methyl-N-(3-morpholin-4-ylpropyl)carbonimidoyl]-1,3-diazinane-2,4,6-trione |
| SMILES | C/C(=N\CCCN1CCOCC1)C1C(=O)NC(=O)N(C2CCCCC2)C1=O |
| InChI | InChI=1S/C19H30N4O4/c1-14(20-8-5-9-22-10-12-27-13-11-22)16-17(24)21-19(26)23(18(16)25)15-6-3-2-4-7-15/h15-16H,2-13H2,1H3,(H,21,24,26)/b20-14+ |
| InChIKey | SEZHPARGJXUNCN-XSFVSMFZSA-N |
| XLogP | 1.20 |
| TPSA | 91.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|