C14H23N5O2S+2 — CID 7461547
(5S)-1-cyclopropyl-5-(2-piperazine-1,4-diium-1-ylethyliminomethyl)-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 7461547) has the molecular formula C14H23N5O2S+2 and a molecular weight of 325.44 g/mol. Its IUPAC name is (5S)-1-cyclopropyl-5-(2-piperazine-1,4-diium-1-ylethyliminomethyl)-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | (5S)-1-cyclopropyl-5-(2-piperazine-1,4-diium-1-ylethyliminomethyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 7461547 |
| Molecular Formula | C14H23N5O2S+2 |
| Molecular Weight | 325.44 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | (5S)-1-cyclopropyl-5-(2-piperazine-1,4-diium-1-ylethyliminomethyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | O=C1NC(=S)N(C2CC2)C(=O)[C@H]1/C=N/CC[NH+]1CC[NH2+]CC1 |
| InChI | InChI=1S/C14H21N5O2S/c20-12-11(9-16-5-8-18-6-3-15-4-7-18)13(21)19(10-1-2-10)14(22)17-12/h9-11,15H,1-8H2,(H,17,20,22)/p+2/b16-9+/t11-/m0/s1 |
| InChIKey | CNLFIVCUVKIQCQ-UJFYRASASA-P |
| XLogP | -3.46 |
| TPSA | 82.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.44 |
| LogP ≤ 5 | -3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|