C15H27N4O3+ — CID 7461604
2-[1-[(5S)-1-butyl-2,4,6-trioxo-1,3-diazinan-5-yl]propylideneamino]ethyl-dimethylazanium (PubChem CID 7461604) has the molecular formula C15H27N4O3+ and a molecular weight of 311.41 g/mol. Its IUPAC name is 2-[1-[(5S)-1-butyl-2,4,6-trioxo-1,3-diazinan-5-yl]propylideneamino]ethyl-dimethylazanium.
| Compound Name | 2-[1-[(5S)-1-butyl-2,4,6-trioxo-1,3-diazinan-5-yl]propylideneamino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 7461604 |
| Molecular Formula | C15H27N4O3+ |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | 2-[1-[(5S)-1-butyl-2,4,6-trioxo-1,3-diazinan-5-yl]propylideneamino]ethyl-dimethylazanium |
| SMILES | CCCCN1C(=O)NC(=O)[C@H](/C(CC)=N/CC[NH+](C)C)C1=O |
| InChI | InChI=1S/C15H26N4O3/c1-5-7-9-19-14(21)12(13(20)17-15(19)22)11(6-2)16-8-10-18(3)4/h12H,5-10H2,1-4H3,(H,17,20,22)/p+1/b16-11+/t12-/m0/s1 |
| InChIKey | IKPMQJSIUXDOGP-JASJWYONSA-O |
| XLogP | -0.52 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|