C14H23N4O3+ — CID 7461718
dimethyl-[2-[1-(2,4,6-trioxo-1-prop-2-enyl-1,3-diazinan-5-yl)propylideneamino]ethyl]azanium (PubChem CID 7461718) has the molecular formula C14H23N4O3+ and a molecular weight of 295.36 g/mol. Its IUPAC name is dimethyl-[2-[1-(2,4,6-trioxo-1-prop-2-enyl-1,3-diazinan-5-yl)propylideneamino]ethyl]azanium.
| Compound Name | dimethyl-[2-[1-(2,4,6-trioxo-1-prop-2-enyl-1,3-diazinan-5-yl)propylideneamino]ethyl]azanium |
|---|---|
| PubChem CID | 7461718 |
| Molecular Formula | C14H23N4O3+ |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | dimethyl-[2-[1-(2,4,6-trioxo-1-prop-2-enyl-1,3-diazinan-5-yl)propylideneamino]ethyl]azanium |
| SMILES | C=CCN1C(=O)NC(=O)C(/C(CC)=N/CC[NH+](C)C)C1=O |
| InChI | InChI=1S/C14H22N4O3/c1-5-8-18-13(20)11(12(19)16-14(18)21)10(6-2)15-7-9-17(3)4/h5,11H,1,6-9H2,2-4H3,(H,16,19,21)/p+1/b15-10+ |
| InChIKey | VFIYKIHPCRNQSW-XNTDXEJSSA-O |
| XLogP | -1.14 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|