C20H22FN3O2S — CID 7461730
1-[2-(cyclohexen-1-yl)ethyl]-5-[(4-fluorophenyl)methyliminomethyl]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 7461730) has the molecular formula C20H22FN3O2S and a molecular weight of 387.48 g/mol. Its IUPAC name is 1-[2-(cyclohexen-1-yl)ethyl]-5-[(4-fluorophenyl)methyliminomethyl]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 1-[2-(cyclohexen-1-yl)ethyl]-5-[(4-fluorophenyl)methyliminomethyl]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 7461730 |
| Molecular Formula | C20H22FN3O2S |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 1-[2-(cyclohexen-1-yl)ethyl]-5-[(4-fluorophenyl)methyliminomethyl]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | O=C1NC(=S)N(CCC2=CCCCC2)C(=O)C1/C=N/Cc1ccc(F)cc1 |
| InChI | InChI=1S/C20H22FN3O2S/c21-16-8-6-15(7-9-16)12-22-13-17-18(25)23-20(27)24(19(17)26)11-10-14-4-2-1-3-5-14/h4,6-9,13,17H,1-3,5,10-12H2,(H,23,25,27)/b22-13+ |
| InChIKey | PMKCHSQZLGSKFV-LPYMAVHISA-N |
| XLogP | 3.15 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|