C19H25N4O3+ — CID 7461937
[(1R,2R)-2-[[(5R)-1-(3,4-dimethylphenyl)-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]cyclohexyl]azanium (PubChem CID 7461937) has the molecular formula C19H25N4O3+ and a molecular weight of 357.43 g/mol. Its IUPAC name is [(1R,2R)-2-[[(5R)-1-(3,4-dimethylphenyl)-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]cyclohexyl]azanium.
| Compound Name | [(1R,2R)-2-[[(5R)-1-(3,4-dimethylphenyl)-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]cyclohexyl]azanium |
|---|---|
| PubChem CID | 7461937 |
| Molecular Formula | C19H25N4O3+ |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | [(1R,2R)-2-[[(5R)-1-(3,4-dimethylphenyl)-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]cyclohexyl]azanium |
| SMILES | Cc1ccc(N2C(=O)NC(=O)[C@@H](/C=N/[C@@H]3CCCC[C@H]3[NH3+])C2=O)cc1C |
| InChI | InChI=1S/C19H24N4O3/c1-11-7-8-13(9-12(11)2)23-18(25)14(17(24)22-19(23)26)10-21-16-6-4-3-5-15(16)20/h7-10,14-16H,3-6,20H2,1-2H3,(H,22,24,26)/p+1/b21-10+/t14-,15-,16-/m1/s1 |
| InChIKey | GDWWGOZBCROREP-OFPSMEBESA-O |
| XLogP | 1.13 |
| TPSA | 106.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|