C10H13N — CID 7462302
(3S)-3-methyl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 7462302) has the molecular formula C10H13N and a molecular weight of 147.22 g/mol. Its IUPAC name is (3S)-3-methyl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | (3S)-3-methyl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 7462302 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | (3S)-3-methyl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | C[C@H]1Cc2ccccc2CN1 |
| InChI | InChI=1S/C10H13N/c1-8-6-9-4-2-3-5-10(9)7-11-8/h2-5,8,11H,6-7H2,1H3/t8-/m0/s1 |
| InChIKey | UEKQPSAKUNXFHL-QMMMGPOBSA-N |
| XLogP | 1.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |