C21H20N3O4S- — CID 7462429
2-[2-[(4R)-5-(benzylcarbamoyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-4-yl]phenoxy]acetate (PubChem CID 7462429) has the molecular formula C21H20N3O4S- and a molecular weight of 410.48 g/mol. Its IUPAC name is 2-[2-[(4R)-5-(benzylcarbamoyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-4-yl]phenoxy]acetate.
| Compound Name | 2-[2-[(4R)-5-(benzylcarbamoyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-4-yl]phenoxy]acetate |
|---|---|
| PubChem CID | 7462429 |
| Molecular Formula | C21H20N3O4S- |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 2-[2-[(4R)-5-(benzylcarbamoyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-4-yl]phenoxy]acetate |
| SMILES | CC1=C(C(=O)NCc2ccccc2)[C@@H](c2ccccc2OCC(=O)[O-])NC(=S)N1 |
| InChI | InChI=1S/C21H21N3O4S/c1-13-18(20(27)22-11-14-7-3-2-4-8-14)19(24-21(29)23-13)15-9-5-6-10-16(15)28-12-17(25)26/h2-10,19H,11-12H2,1H3,(H,22,27)(H,25,26)(H2,23,24,29)/p-1/t19-/m1/s1 |
| InChIKey | ULPPGPGTIRXPOJ-LJQANCHMSA-M |
| XLogP | 0.92 |
| TPSA | 102.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|