C23H33N5O10 — CID 74627718
(2S)-2-[[(1S)-5-[[2-(2-acetamidoethoxy)phenyl]carbamoylamino]-1-carboxypentyl]carbamoylamino]pentanedioic acid (PubChem CID 74627718) has the molecular formula C23H33N5O10 and a molecular weight of 539.54 g/mol. Its IUPAC name is (2S)-2-[[(1S)-5-[[2-(2-acetamidoethoxy)phenyl]carbamoylamino]-1-carboxypentyl]carbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[[(1S)-5-[[2-(2-acetamidoethoxy)phenyl]carbamoylamino]-1-carboxypentyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 74627718 |
| Molecular Formula | C23H33N5O10 |
| Molecular Weight | 539.54 g/mol |
| Exact Mass | 539.22 |
| IUPAC Name | (2S)-2-[[(1S)-5-[[2-(2-acetamidoethoxy)phenyl]carbamoylamino]-1-carboxypentyl]carbamoylamino]pentanedioic acid |
| SMILES | CC(=O)NCCOc1ccccc1NC(=O)NCCCC[C@H](NC(=O)N[C@@H](CCC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C23H33N5O10/c1-14(29)24-12-13-38-18-8-3-2-6-15(18)26-22(36)25-11-5-4-7-16(20(32)33)27-23(37)28-17(21(34)35)9-10-19(30)31/h2-3,6,8,16-17H,4-5,7,9-13H2,1H3,(H,24,29)(H,30,31)(H,32,33)(H,34,35)(H2,25,26,36)(H2,27,28,37)/t16-,17-/m0/s1 |
| InChIKey | CRUKQOKBAZCGKG-IRXDYDNUSA-N |
| XLogP | 0.56 |
| TPSA | 232.49 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.54 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|