C21H30O2 — CID 74627731
(Z)-3,7-dimethyl-8-(7-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)oct-6-enoic acid (PubChem CID 74627731) has the molecular formula C21H30O2 and a molecular weight of 314.47 g/mol. Its IUPAC name is (Z)-3,7-dimethyl-8-(7-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)oct-6-enoic acid.
| Compound Name | (Z)-3,7-dimethyl-8-(7-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)oct-6-enoic acid |
|---|---|
| PubChem CID | 74627731 |
| Molecular Formula | C21H30O2 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | (Z)-3,7-dimethyl-8-(7-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)oct-6-enoic acid |
| SMILES | C/C(=C/CCC(C)CC(=O)O)CC1CCCc2ccc(C)cc21 |
| InChI | InChI=1S/C21H30O2/c1-15(6-4-7-16(2)14-21(22)23)12-19-9-5-8-18-11-10-17(3)13-20(18)19/h6,10-11,13,16,19H,4-5,7-9,12,14H2,1-3H3,(H,22,23)/b15-6- |
| InChIKey | GOUFLTGKPRCDDK-UUASQNMZSA-N |
| XLogP | 5.64 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|