C13H21NO3 — CID 74627779
2-[(1R,2R,3E)-3-methoxyimino-2-[(Z)-pent-2-enyl]cyclopentyl]acetic acid (PubChem CID 74627779) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is 2-[(1R,2R,3E)-3-methoxyimino-2-[(Z)-pent-2-enyl]cyclopentyl]acetic acid.
| Compound Name | 2-[(1R,2R,3E)-3-methoxyimino-2-[(Z)-pent-2-enyl]cyclopentyl]acetic acid |
|---|---|
| PubChem CID | 74627779 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 2-[(1R,2R,3E)-3-methoxyimino-2-[(Z)-pent-2-enyl]cyclopentyl]acetic acid |
| SMILES | CC/C=C\C[C@H]1/C(=N/OC)CC[C@@H]1CC(=O)O |
| InChI | InChI=1S/C13H21NO3/c1-3-4-5-6-11-10(9-13(15)16)7-8-12(11)14-17-2/h4-5,10-11H,3,6-9H2,1-2H3,(H,15,16)/b5-4-,14-12+/t10-,11-/m1/s1 |
| InChIKey | MJYRGIWGWHKOLA-MZNYGPFDSA-N |
| XLogP | 2.85 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|