About (5-chloroquinolin-8-yl) pyridine-3-carboxylate
(5-chloroquinolin-8-yl) pyridine-3-carboxylate (PubChem CID 746299) has the molecular formula C15H9ClN2O2
and a molecular weight of 284.70 g/mol. Its IUPAC name is (5-chloroquinolin-8-yl) pyridine-3-carboxylate.
Molecular Properties
| Compound Name | (5-chloroquinolin-8-yl) pyridine-3-carboxylate |
| PubChem CID | 746299 |
| Molecular Formula | C15H9ClN2O2 |
| Molecular Weight | 284.70 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | (5-chloroquinolin-8-yl) pyridine-3-carboxylate |
| SMILES | O=C(Oc1ccc(Cl)c2cccnc12)c1cccnc1 |
| InChI | InChI=1S/C15H9ClN2O2/c16-12-5-6-13(14-11(12)4-2-8-18-14)20-15(19)10-3-1-7-17-9-10/h1-9H |
| InChIKey | TZPKUYDXEWNSDK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.70 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (5-chloroquinolin-8-yl) pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-chloroquinolin-8-yl) pyridine-3-carboxylate?
The IUPAC name of (5-chloroquinolin-8-yl) pyridine-3-carboxylate (CID 746299) is (5-chloroquinolin-8-yl) pyridine-3-carboxylate.
What is the SMILES notation for (5-chloroquinolin-8-yl) pyridine-3-carboxylate?
The canonical SMILES for (5-chloroquinolin-8-yl) pyridine-3-carboxylate is O=C(Oc1ccc(Cl)c2cccnc12)c1cccnc1.
What is the InChIKey of (5-chloroquinolin-8-yl) pyridine-3-carboxylate?
The InChIKey is TZPKUYDXEWNSDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9ClN2O2/c16-12-5-6-13(14-11(12)4-2-8-18-14)20-15(19)10-3-1-7-17-9-10/h1-9H.
What are the key properties of (5-chloroquinolin-8-yl) pyridine-3-carboxylate?
(5-chloroquinolin-8-yl) pyridine-3-carboxylate has a molecular weight of 284.70 g/mol, XLogP of 3.50, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-chloroquinolin-8-yl) pyridine-3-carboxylate is sourced from PubChem (CID 746299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).