C7H12N7O+ — CID 74636015
8-amino-6-tert-butyl-3H-tetrazolo[1,5-b][1,2,4]triazin-4-ium-7-one (PubChem CID 74636015) has the molecular formula C7H12N7O+ and a molecular weight of 210.22 g/mol. Its IUPAC name is 8-amino-6-tert-butyl-3H-tetrazolo[1,5-b][1,2,4]triazin-4-ium-7-one.
| Compound Name | 8-amino-6-tert-butyl-3H-tetrazolo[1,5-b][1,2,4]triazin-4-ium-7-one |
|---|---|
| PubChem CID | 74636015 |
| Molecular Formula | C7H12N7O+ |
| Molecular Weight | 210.22 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 8-amino-6-tert-butyl-3H-tetrazolo[1,5-b][1,2,4]triazin-4-ium-7-one |
| SMILES | CC(C)(C)c1n[n+]2[nH]nnc2n(N)c1=O |
| InChI | InChI=1S/C7H11N7O/c1-7(2,3)4-5(15)13(8)6-9-11-12-14(6)10-4/h8H2,1-3H3/p+1 |
| InChIKey | NOAQIMMISBEIEV-UHFFFAOYSA-O |
| XLogP | -1.89 |
| TPSA | 106.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.22 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|