About N-(4-phenyl-1,3-thiazol-2-yl)benzamide
N-(4-phenyl-1,3-thiazol-2-yl)benzamide (PubChem CID 746475) has the molecular formula C16H12N2OS
and a molecular weight of 280.35 g/mol. Its IUPAC name is N-(4-phenyl-1,3-thiazol-2-yl)benzamide.
Molecular Properties
| Compound Name | N-(4-phenyl-1,3-thiazol-2-yl)benzamide |
| PubChem CID | 746475 |
| Molecular Formula | C16H12N2OS |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | N-(4-phenyl-1,3-thiazol-2-yl)benzamide |
| SMILES | O=C(Nc1nc(-c2ccccc2)cs1)c1ccccc1 |
| InChI | InChI=1S/C16H12N2OS/c19-15(13-9-5-2-6-10-13)18-16-17-14(11-20-16)12-7-3-1-4-8-12/h1-11H,(H,17,18,19) |
| InChIKey | NIRMZOKDACPPER-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4-phenyl-1,3-thiazol-2-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-phenyl-1,3-thiazol-2-yl)benzamide?
The IUPAC name of N-(4-phenyl-1,3-thiazol-2-yl)benzamide (CID 746475) is N-(4-phenyl-1,3-thiazol-2-yl)benzamide.
What is the SMILES notation for N-(4-phenyl-1,3-thiazol-2-yl)benzamide?
The canonical SMILES for N-(4-phenyl-1,3-thiazol-2-yl)benzamide is O=C(Nc1nc(-c2ccccc2)cs1)c1ccccc1.
What is the InChIKey of N-(4-phenyl-1,3-thiazol-2-yl)benzamide?
The InChIKey is NIRMZOKDACPPER-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N2OS/c19-15(13-9-5-2-6-10-13)18-16-17-14(11-20-16)12-7-3-1-4-8-12/h1-11H,(H,17,18,19).
What are the key properties of N-(4-phenyl-1,3-thiazol-2-yl)benzamide?
N-(4-phenyl-1,3-thiazol-2-yl)benzamide has a molecular weight of 280.35 g/mol, XLogP of 4.06, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-phenyl-1,3-thiazol-2-yl)benzamide is sourced from PubChem (CID 746475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).